CAS 13398-94-2
:3-Hydroxybenzeneethanol
Description:
3-Hydroxybenzeneethanol, also known as meta-tyrosol, is an organic compound characterized by the presence of both a hydroxyl group (-OH) and an alcohol group (-CH2OH) attached to a benzene ring. Its molecular structure features a phenolic hydroxyl group positioned meta to the ethanol side chain, which contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid with a mild aromatic odor. It is soluble in water and organic solvents, making it versatile in various applications. 3-Hydroxybenzeneethanol exhibits antioxidant properties, which are of interest in food and pharmaceutical industries, particularly for its potential health benefits. Additionally, it can participate in various chemical reactions, including oxidation and esterification, due to the reactivity of its hydroxyl groups. Its CAS number, 13398-94-2, is used for identification in chemical databases and regulatory frameworks. Overall, 3-Hydroxybenzeneethanol is a significant compound in both synthetic and natural chemistry contexts.
Formula:C8H10O2
InChI:InChI=1S/C8H10O2/c9-5-4-7-2-1-3-8(10)6-7/h1-3,6,9-10H,4-5H2
InChI key:InChIKey=AMQIPHZFLIDOCB-UHFFFAOYSA-N
SMILES:C(CO)C1=CC(O)=CC=C1
Synonyms:- 1,3-Tyrosol
- 2-(3-Hydroxyphenyl)Ethanol
- 2-(3-Hydroxyphenyl)ethyl alcohol
- 2-(m-Hydroxyphenyl)ethanol
- 3-(2-Hydroxyethyl)Phenol
- 3-(β-Hydroxyethyl)phenol
- 3-Hydroxybenzeneethanol
- Benzeneethanol, 3-hydroxy-
- NSC 101846
- Phenethyl alcohol, m-hydroxy-
- m-Hydroxyphenethyl alcohol
- m-Hydroxyphenylethyl alcohol
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Hydroxyphenethyl alcohol
CAS:Formula:C8H10O2Purity:99%Color and Shape:LiquidMolecular weight:138.16383-Hydroxyphenethyl alcohol
CAS:Formula:C8H10O2Purity:(HPLC) ≥ 98.0%Color and Shape:Colourless to brown viscous liquidMolecular weight:138.163-Hydroxyphenethyl alcohol
CAS:3-Hydroxyphenethyl alcoholPurity:96%Color and Shape:Pale Yellow LiquidMolecular weight:138.16g/mol2-(3-Hydroxyphenyl)ethyl alcohol
CAS:2-(3-Hydroxyphenyl)ethyl alcohol is a reactive compound that can form an adduct with the tyrosinase enzyme, which catalyzes the conversion of tyrosine to dopa and dopaquinone. 2-(3-Hydroxyphenyl)ethyl alcohol also has been shown to inhibit tyrosinase activity in vitro. This compound has been found in natural compounds such as catechins and flavones.Formula:C8H10O2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:138.16 g/mol





