CAS 133982-66-8

1-(4-fluorophenyl)-4-(4-(5-fluoro-2-pyrimidinyl)-1-piperazinyl)butan-1-one

Description:

1-(4-fluorophenyl)-4-(4-(5-fluoro-2-pyrimidinyl)-1-piperazinyl)butan-1-one, with the CAS number 133982-66-8, is a synthetic organic compound characterized by its complex structure, which includes a butanone backbone, a piperazine ring, and multiple fluorine and pyrimidine substituents. This compound is typically classified as a pharmaceutical intermediate or a potential drug candidate, often investigated for its biological activity, particularly in the context of neuropharmacology. The presence of fluorine atoms enhances lipophilicity and metabolic stability, which can influence the compound's pharmacokinetic properties. The piperazine moiety is commonly associated with various pharmacological effects, including anxiolytic and antidepressant activities. Additionally, the pyrimidine ring may contribute to interactions with specific biological targets, such as receptors or enzymes. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of therapeutics targeting central nervous system disorders.

Formula: C₁₈H₂₀F₂N₄O

InChI: InChI=1/C18H20F2N4O/c19-15-5-3-14(4-6-15)17(25)2-1-7-23-8-10-24(11-9-23)18-21-12-16(20)13-22-18/h3-6,12-13H,1-2,7-11H2

SMILES: C(CC(=O)c1ccc(cc1)F)CN1CCN(CC1)c1ncc(cn1)F

Synonyms:

• Ffppb
• 1-Butanone, 1-(4-fluorophenyl)-4-(4-(5-fluoro-2-pyrimidinyl)-1-piperazinyl)-
• 1-(4-Fluorophenyl)-4-[4-(5-Fluoropyrimidin-2-Yl)Piperazin-1-Yl]Butan-1-One