
CAS 1339860-94-4
:4-Methyl-N-(2-methylbutyl)-3-pyridinamine
Description:
4-Methyl-N-(2-methylbutyl)-3-pyridinamine, identified by its CAS number 1339860-94-4, is an organic compound featuring a pyridine ring substituted with a methyl group and an amine functional group. This compound is characterized by its nitrogen-containing heterocyclic structure, which contributes to its potential biological activity. The presence of the 2-methylbutyl group enhances its hydrophobic properties, influencing its solubility and interaction with biological membranes. Typically, compounds of this nature may exhibit various pharmacological effects, making them of interest in medicinal chemistry. The molecular structure suggests potential for hydrogen bonding due to the amine group, which can affect its reactivity and interaction with other molecules. Additionally, the compound's stability, boiling point, and melting point would depend on its specific molecular interactions and the presence of functional groups. Overall, 4-Methyl-N-(2-methylbutyl)-3-pyridinamine represents a class of compounds that may have applications in drug development and other chemical industries.
Formula:C11H18N2
InChI:InChI=1S/C11H18N2/c1-4-9(2)7-13-11-8-12-6-5-10(11)3/h5-6,8-9,13H,4,7H2,1-3H3
InChI key:InChIKey=OTEMBRUSIMRZRF-UHFFFAOYSA-N
SMILES:N(CC(CC)C)C=1C(C)=CC=NC1
Synonyms:- 3-Pyridinamine, 4-methyl-N-(2-methylbutyl)-
- 4-Methyl-N-(2-methylbutyl)-3-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.