CAS 1339892-67-9

2-(2-Oxaspiro[3.3]hept-6-ylidene)acetonitrile

Description:

2-(2-Oxaspiro[3.3]hept-6-ylidene)acetonitrile is a chemical compound characterized by its unique spirocyclic structure, which features a spiro linkage between two rings, contributing to its rigidity and potential for interesting stereochemistry. The presence of the oxaspiro moiety indicates that it contains an oxygen atom within the spiro structure, which can influence its reactivity and interactions with other molecules. The acetonitrile functional group introduces a nitrile (-C≡N) group, which is known for its polar character and ability to participate in various chemical reactions, including nucleophilic additions and coordination with metal ions. This compound may exhibit interesting properties such as solubility in polar solvents, potential biological activity, and utility in organic synthesis. Its specific applications and behavior would depend on the context of its use, including potential roles in pharmaceuticals, materials science, or as an intermediate in chemical synthesis. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₈H₉NO

InChI: InChI=1S/C8H9NO/c9-2-1-7-3-8(4-7)5-10-6-8/h1H,3-6H2

InChI key: InChIKey=XYCFQQUAIAXFMX-UHFFFAOYSA-N

SMILES: C(C#N)=C1CC2(C1)COC2

Synonyms:

• 2-[2-Oxaspiro[3.3]heptan-6-ylidene]acetonitrile
• 2-(2-Oxaspiro[3.3]hept-6-ylidene)acetonitrile
• Acetonitrile, 2-(2-oxaspiro[3.3]hept-6-ylidene)-

Acetonitrile, 2-(2-oxaspiro[3.3]hept-6-ylidene)-

CAS: 1339892-67-9

Formula: C₈H₉NO

Purity: 96%

Molecular weight: 135.1632

Ref: IN-DA00OS8N