CAS 1339909-52-2

1-(2-Furanylmethyl)-3,5-dimethyl-1H-pyrazole-4-carboxylic acid

Description:

1-(2-Furanylmethyl)-3,5-dimethyl-1H-pyrazole-4-carboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a carboxylic acid group and a furanylmethyl group. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, including potential reactivity due to the presence of the carboxylic acid functional group. The furanyl moiety may contribute to its aromatic character and influence its solubility and stability in various solvents. The presence of methyl groups on the pyrazole ring can affect its steric hindrance and electronic properties, potentially enhancing its biological activity or reactivity in chemical reactions. This compound may be of interest in medicinal chemistry and material science due to its structural features, which could lead to various applications, including as a building block in organic synthesis or as a potential pharmacophore in drug development. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₁H₁₂N₂O₃

InChI: InChI=1S/C11H12N2O3/c1-7-10(11(14)15)8(2)13(12-7)6-9-4-3-5-16-9/h3-5H,6H2,1-2H3,(H,14,15)

InChI key: InChIKey=DUPBXGGFBNNKFE-UHFFFAOYSA-N

SMILES: C(N1C(C)=C(C(O)=O)C(C)=N1)C2=CC=CO2

Synonyms:

• 1H-Pyrazole-4-carboxylic acid, 1-(2-furanylmethyl)-3,5-dimethyl-
• 1-(2-Furanylmethyl)-3,5-dimethyl-1H-pyrazole-4-carboxylic acid