CAS 133991-33-0
:Benzenecarboximidamide,4,4'-[(3-hydroxy-1,5-pentanediyl)bis(oxy)]bis-
Description:
Benzenecarboximidamide, 4,4'-[(3-hydroxy-1,5-pentanediyl)bis(oxy)]bis- is a chemical compound characterized by its complex structure, which includes a benzene ring and an amidine functional group. The presence of the hydroxy and ether linkages in its structure suggests potential for hydrogen bonding and solubility in polar solvents. This compound may exhibit properties typical of amidines, such as basicity and the ability to act as a nucleophile. Its molecular architecture indicates potential applications in pharmaceuticals or as a biochemical reagent, particularly due to the functional groups that can participate in various chemical reactions. The CAS number 133991-33-0 uniquely identifies this substance, facilitating its recognition in chemical databases and literature. As with many organic compounds, its stability, reactivity, and specific applications would depend on the surrounding conditions, such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential uses in various fields.
Formula:C19H24N4O3
InChI:InChI=1S/C19H24N4O3/c20-18(21)13-1-5-16(6-2-13)25-11-9-15(24)10-12-26-17-7-3-14(4-8-17)19(22)23/h1-8,15,24H,9-12H2,(H3,20,21)(H3,22,23)
InChI key:InChIKey=LZRGIVAJLHKJOI-UHFFFAOYSA-N
SMILES:O(CCC(CCOC1=CC=C(C(=N)N)C=C1)O)C2=CC=C(C(=N)N)C=C2
Synonyms:- 4,4′-[(3-Hydroxy-1,5-pentanediyl)bis(oxy)]bis[benzenecarboximidamide]
- Benzenecarboximidamide, 4,4′-[(3-hydroxy-1,5-pentanediyl)bis(oxy)]bis-
- 1,5-Bis(4-aMidinophenoxy)-3-pentanol
- 1,5-Di(4-aMidinophenoxy)-3-pentanol
- 4,4'-[(3-Hydroxy-1,5-pentanediyl)bis(oxy)]bisbenzenecarboxiMidaMide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,5-Bis(4-amidinophenoxy)-3-pentanol
CAS:Controlled ProductFormula:C19H24N4O3Color and Shape:NeatMolecular weight:356.419
