CymitQuimica logo

CAS 133992-56-0

:

5-(Azidomethyl)-1,2,3-trimethoxybenzene

Description:
5-(Azidomethyl)-1,2,3-trimethoxybenzene is an organic compound characterized by the presence of an azide functional group (-N3) attached to a benzene ring that is further substituted with three methoxy groups (-OCH3) at the 1, 2, and 3 positions. This compound typically exhibits properties associated with aromatic compounds, such as stability and distinct reactivity due to the electron-donating nature of the methoxy groups, which can influence its electrophilic and nucleophilic behavior. The azide group introduces unique reactivity, making it a potential candidate for click chemistry applications, particularly in the synthesis of more complex molecules. The presence of multiple methoxy groups can enhance solubility in organic solvents and may affect the compound's overall polarity. Additionally, the compound's structure suggests potential applications in medicinal chemistry and materials science, particularly in the development of functionalized polymers or drug candidates. Safety considerations should be taken into account due to the inherent reactivity of the azide group, which can be sensitive to heat and shock.
Formula:C10H13N3O3
InChI:InChI=1S/C10H13N3O3/c1-14-8-4-7(6-12-13-11)5-9(15-2)10(8)16-3/h4-5H,6H2,1-3H3
InChI key:InChIKey=MWLYDECOHPRVOB-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C(OC)=CC(CN=[N+]=[N-])=C1
Synonyms:
  • Benzene, 5-(azidomethyl)-1,2,3-trimethoxy-
  • 3,4,5-Trimethoxybenzyl azide
  • 5-(Azidomethyl)-1,2,3-trimethoxybenzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.