CAS 133997-05-4

4-(N-OCTYL)BENZENEBORONIC ACID

Description:

4-(N-Octyl)benzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring, which is further substituted with an octyl group. This structure imparts both hydrophobic and polar characteristics, making it soluble in organic solvents while exhibiting some degree of solubility in water due to the boronic acid moiety. The compound is typically used in organic synthesis, particularly in Suzuki coupling reactions, where it serves as a versatile building block for the formation of carbon-carbon bonds. Its boronic acid group can also participate in reversible covalent bonding with diols, which is useful in various applications, including sensor technology and drug delivery systems. Additionally, the octyl chain enhances the lipophilicity of the molecule, potentially influencing its biological activity and interaction with lipid membranes. Overall, 4-(N-octyl)benzeneboronic acid is a valuable compound in both synthetic organic chemistry and materials science.

Formula: C₁₄H₂₃BO₂

InChI: InChI=1/C14H23BO2/c1-2-3-4-5-6-7-8-13-9-11-14(12-10-13)15(16)17/h9-12,16-17H,2-8H2,1H3

SMILES: CCCCCCCCc1ccc(cc1)B(O)O

Synonyms:

• Akos Brn-0161
• 4-N-Octylphenylboronic Acid
• (4-Octylphenyl)Boronic Acid

4-(N-Octyl)benzeneboronic acid

CAS: 133997-05-4

Formula: C₁₄H₂₃BO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 234.1422

Ref: IN-DA009AVT

4-(n-Octyl)benzeneboronic acid

CAS: 133997-05-4

4-(n-Octyl)benzeneboronic acid

Purity: 97%

Color and Shape: White Solid

Molecular weight: 234.14g/mol

Ref: 54-OR7246

4-(n-Octyl)benzeneboronic acid

CAS: 133997-05-4

4-(n-Octyl)benzeneboronic acid is a molecule that can be used in high-performance thermal chemistries. It has been shown to have a tunable emission spectrum, which makes it an ideal component for use in OLEDs. 4-(n-Octyl)benzeneboronic acid is stable and emits light efficiently at room temperature. This molecule is also used as a precursor for organic molecules, such as the fluorescent dye rhodamine 6G or the anti-inflammatory drug indomethacin.

Formula: C₁₄H₂₃BO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 234.14 g/mol

Ref: 3D-IFA99705

4-(N-Octyl)benzeneboronic acid

CAS: 133997-05-4

Purity: 97%

Molecular weight: 234.1499939

Ref: 10-F623349