CAS 134-01-0
:Peonidin
Description:
Peonidin is a naturally occurring anthocyanidin, a type of flavonoid pigment responsible for the red, purple, and blue colors in many fruits and flowers. It is commonly found in various plants, particularly in berries and certain flowers. Peonidin is characterized by its chemical structure, which includes a 3,5-dimethoxy substitution on the B-ring of the anthocyanin structure, contributing to its unique color properties. The compound exhibits antioxidant activity, which is beneficial for health, as it helps to neutralize free radicals in the body. Peonidin is soluble in water and alcohol, making it useful in food and beverage applications as a natural colorant. Additionally, it has been studied for its potential health benefits, including anti-inflammatory and anti-cancer properties. Its stability can be affected by pH and light exposure, which is important for its application in food products. Overall, peonidin is a significant compound in both the food industry and nutritional research due to its vibrant color and potential health benefits.
Formula:C16H13O6·Cl
InChI:InChI=1S/C16H12O6.ClH/c1-21-15-4-8(2-3-11(15)18)16-13(20)7-10-12(19)5-9(17)6-14(10)22-16;/h2-7H,1H3,(H3-,17,18,19,20);1H
InChI key:InChIKey=OGBSHLKSHNAPEW-UHFFFAOYSA-N
SMILES:OC=1C(=[O+]C2=C(C1)C(O)=CC(O)=C2)C3=CC(OC)=C(O)C=C3.[Cl-]
Synonyms:- 1-Benzopyrylium, 3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-, chloride
- 1-Benzopyrylium, 3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-, chloride (1:1)
- 3,4′,5,7-Tetrahydroxy-3′-methoxy-2-phenylbenzopyrylium chloride
- 3,4′,5,7-Tetrahydroxy-3′-methoxyflavylium chloride
- 3,5,7-Trihydroxy-2-(4-Hydroxy-3-Methoxyphenyl)Chromenium Chloride
- Flavylium, 3,4′,5,7-tetrahydroxy-3′-methoxy-, chloride
- Paeonidin
- Peonidin
- Peonidin chloride
- Peonidol chloride
- Ygm 6
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Peonidin chloride
CAS:Peonidin chloride analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C16H13O6ClPurity:(HPLC) ≥97%Color and Shape:PowderMolecular weight:336.73Peonidin chloride
CAS:Peonidin chloride has antioxidant activity.Formula:C16H13ClO6Purity:98%Color and Shape:SolidMolecular weight:336.72Peonidin chloride
CAS:Oxygen-heterocyclic compoundFormula:C16H13O6ClPurity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:336.73Peonidin chloride
CAS:<p>Peonidin chloride is an anthocyanin compound commonly isolated from the plant kingdom, specifically from the vibrant pigments found in flowers like peonies and certain fruits. As a naturally occurring phenolic compound, peonidin chloride serves as a powerful antioxidant, counteracting oxidative stress by scavenging free radicals. This mode of action is crucial for studying mechanisms involved in cellular protection and signaling pathways.</p>Formula:C16H13O6ClPurity:Min. 97 Area-%Color and Shape:Red PowderMolecular weight:336.72 g/molPeonidin Chloride-d3
CAS:Controlled ProductFormula:C16H10D3O6•ClColor and Shape:NeatMolecular weight:339.74Peonidin Chloride
CAS:Controlled ProductFormula:C16H13O6·ClColor and Shape:NeatMolecular weight:336.72






