CAS 134-04-3: Pelargonidin chloride
Description:Pelargonidin chloride is a chemical compound classified as an anthocyanidin, which is a type of flavonoid pigment commonly found in various fruits and flowers, contributing to their red, orange, and purple colors. It is characterized by its bright red hue, which is particularly prominent in certain berries and ornamental plants. The compound is soluble in water and exhibits a pH-dependent color change, typically appearing red in acidic conditions and shifting to a more bluish hue in neutral to alkaline environments. Pelargonidin chloride is known for its antioxidant properties, which can provide health benefits, and it is often studied for its potential applications in food coloring and natural dyes. Additionally, it has been investigated for its role in plant physiology and its effects on human health, including anti-inflammatory and anti-cancer properties. As a chloride salt, it contains chloride ions, which can influence its solubility and reactivity in various chemical environments.
Formula:C15H11O5·Cl
InChI:InChI=1S/C15H10O5.ClH/c16-9-3-1-8(2-4-9)15-13(19)7-11-12(18)5-10(17)6-14(11)20-15;/h1-7H,(H3-,16,17,18,19);1H
InChI key:InChIKey=YPVZJXMTXCOTJN-UHFFFAOYSA-N
SMILES:[Cl-].OC=1C=CC(=CC1)C2=[O+]C=3C=C(O)C=C(O)C3C=C2O
- Synonyms:
- 1-Benzopyrylium, 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-, chloride
- 1-Benzopyrylium, 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-, chloride (1:1)
- 3,4,5,7-Tetrahydroxyflavylium Chloride
- 3,5,7-Trihydroxy-2-(4-Hydroxyphenyl)Chromenium Chloride
- Flavylium, 3,4′,5,7-tetrahydroxy-, chloride
- Pelargonidin
- Pelargonidin Chloride
- Pelargonidol chloride
