CAS 134-17-8
:4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol - hex-1-enofuranos-3-ulose (1:1)
Description:
The chemical substance known as "4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol - hex-1-enofuranos-3-ulose (1:1)" with CAS number 134-17-8 is a complex organic compound that features multiple functional groups, including hydroxyl, amino, and furanosyl structures. This compound is characterized by its potential biological activity, often studied in the context of its role in various biochemical pathways. The presence of the benzene ring contributes to its aromatic properties, while the hydroxyl groups enhance its solubility in polar solvents and may facilitate hydrogen bonding. The methylamino group suggests potential interactions with biological systems, possibly influencing its pharmacological properties. Additionally, the furanosyl component indicates a cyclic structure that may participate in carbohydrate-like reactivity. Overall, this compound's unique structural features make it of interest in medicinal chemistry and biochemistry, particularly in the development of therapeutic agents or as a biochemical probe. Its stability, reactivity, and interactions with other molecules would be key areas for further investigation in research settings.
Formula:C15H21NO9
InChI:InChI=1/C9H13NO3.C6H8O6/c1-10-5-9(13)6-2-3-7(11)8(12)4-6;7-1-2(8)5-3(9)4(10)6(11)12-5/h2-4,9-13H,5H2,1H3;2,5,7-8,10-11H,1H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
l-Adrenalin ascorbinate
CAS:l-Adrenalin ascorbinate is a bioactive chemical.Formula:C15H21NO9Color and Shape:SolidMolecular weight:359.33
