
CAS 134-95-2
:Benzeneacetic acid, α-hydroxy-, calcium salt (2:1)
Description:
Benzeneacetic acid, α-hydroxy-, calcium salt (2:1), commonly referred to as calcium α-hydroxybenzeneacetate, is an organic compound characterized by its calcium salt form of α-hydroxybenzeneacetic acid. This compound typically appears as a white to off-white solid and is soluble in water, which is a notable feature for its applications in various fields. It is often utilized in the pharmaceutical and cosmetic industries due to its potential benefits in skin care formulations, acting as a moisturizer and exfoliant. The presence of the calcium ion contributes to its stability and enhances its bioavailability. Additionally, this compound may exhibit mild antibacterial properties, making it useful in topical applications. Its chemical structure includes a benzene ring, which is characteristic of aromatic compounds, and a carboxylic acid functional group, contributing to its acidity and reactivity. Overall, calcium α-hydroxybenzeneacetate is valued for its multifunctional properties, making it a versatile ingredient in various formulations.
Formula:C8H8O3Ca
InChI:InChI=1S/C8H8O3.Ca/c9-7(8(10)11)6-4-2-1-3-5-6;/h1-5,7,9H,(H,10,11);
InChI key:InChIKey=VZUDGLMLVNVCHF-UHFFFAOYSA-N
SMILES:C(C(O)=O)(O)C1=CC=CC=C1.[Ca]
Synonyms:- Benzeneacetic acid, α-hydroxy-, calcium salt (2:1)
- Calcium mandelate
- Camandeline
- Mandelic acid, calcium salt (2:1)
- Amandacide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.