CAS 134003-03-5

(1S,4R)-2-Azabicyclo[2.2.1]heptan-3-one

Description:

(1S,4R)-2-Azabicyclo[2.2.1]heptan-3-one, with the CAS number 134003-03-5, is a bicyclic compound characterized by a nitrogen atom incorporated into a seven-membered ring structure. This compound features a ketone functional group at the 3-position, contributing to its reactivity and potential applications in organic synthesis. The stereochemistry indicated by the (1S,4R) configuration suggests specific spatial arrangements of its substituents, which can influence its biological activity and interaction with other molecules. Typically, azabicyclic compounds like this one exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of the nitrogen atom can enhance solubility and alter the compound's ability to interact with biological targets, such as receptors or enzymes. Overall, (1S,4R)-2-Azabicyclo[2.2.1]heptan-3-one represents a unique structure that may serve as a scaffold for the development of novel therapeutic agents.

Formula: C₆H₉NO

InChI: InChI=1/C6H9NO/c8-6-4-1-2-5(3-4)7-6/h4-5H,1-3H2,(H,7,8)/t4-,5+/m1/s1

(1S,4R)-2-Azabicyclo[2.2.1]heptan-3-one

CAS: 134003-03-5

Formula: C₆H₉NO

Purity: 98%

Molecular weight: 111.1418

Ref: IN-DA009ASO

(1S,4R)-2-Azabicyclo[2.2.1]heptan-3-one

CAS: 134003-03-5

(1S,4R)-2-Azabicyclo[2.2.1]heptan-3-one

Purity: 98%

Molecular weight: 111.14g/mol

Ref: 54-OR1033142

(1S,4R)-2-Azabicyclo[2.2.1]heptan-3-one

CAS: 134003-03-5

Formula: C₆H₉NO

Purity: 98%

Color and Shape: Solid

Molecular weight: 111.144

Ref: 10-F435858