
CAS 134016-72-1
:Poly(5-amino-1-naphthol)
Description:
Poly(5-amino-1-naphthol) is a synthetic polymer characterized by its repeating units derived from 5-amino-1-naphthol, an aromatic amine. This polymer exhibits notable solubility in various organic solvents, which can facilitate its application in different chemical processes. The presence of amino groups in its structure contributes to its potential reactivity, allowing for further functionalization or cross-linking with other materials. Poly(5-amino-1-naphthol) is known for its vibrant color, which can be attributed to the naphthol moiety, making it useful in dye applications. Additionally, it may exhibit properties such as thermal stability and resistance to degradation, depending on its molecular weight and degree of polymerization. Its unique characteristics make it suitable for applications in fields such as textiles, coatings, and potentially in biomedical fields due to its biocompatibility. However, specific properties such as mechanical strength, conductivity, and thermal behavior can vary based on the synthesis method and processing conditions.
Formula:(C10H9NO)x
InChI:InChI=1S/C10H9NO/c11-9-5-1-4-8-7(9)3-2-6-10(8)12/h1-6,12H,11H2
InChI key:InChIKey=ZBIBQNVRTVLOHQ-UHFFFAOYSA-N
SMILES:NC=1C2=C(C(O)=CC=C2)C=CC1
Synonyms:- Poly(5-amino-1-naphthol)
- 5-Amino-1-naphthol homopolymer
- 1-Naphthalenol, 5-amino-, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
