CAS 13402-97-6
:2-[4-(1,1,3,3-Tetramethylbutyl)phenoxy]acetic acid
Description:
2-[4-(1,1,3,3-Tetramethylbutyl)phenoxy]acetic acid, with the CAS number 13402-97-6, is an organic compound characterized by its phenoxyacetic acid structure, which includes a bulky tetramethylbutyl group. This compound is typically a white to off-white solid at room temperature and is soluble in organic solvents, while its solubility in water is limited due to its hydrophobic characteristics. It exhibits properties that make it useful in various applications, including as a surfactant or emulsifier in formulations. The presence of the phenoxy and acetic acid functional groups contributes to its potential reactivity and interaction with biological systems. Additionally, the bulky tetramethylbutyl group enhances its hydrophobicity, which can influence its behavior in different environments, such as in agricultural or industrial applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper precautions are taken.
Formula:C16H24O3
InChI:InChI=1S/C16H24O3/c1-15(2,3)11-16(4,5)12-6-8-13(9-7-12)19-10-14(17)18/h6-9H,10-11H2,1-5H3,(H,17,18)
InChI key:InChIKey=GPLFPJQMVKFQMK-UHFFFAOYSA-N
SMILES:C(CC(C)(C)C)(C)(C)C1=CC=C(OCC(O)=O)C=C1
Synonyms:- Acetic acid, [p-(1,1,3,3-tetramethylbutyl)phenoxy]-
- Acetic acid, [4-(1,1,3,3-tetramethylbutyl)phenoxy]-
- 2-[4-(1,1,3,3-Tetramethylbutyl)phenoxy]acetic acid
- Acetic acid, 2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]-
- [4-(1,1,3,3-Tetramethylbutyl)phenoxy]acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
[4-(1,1,3,3-Tetramethylbutyl)phenoxy]acetic acid
CAS:Controlled ProductFormula:C16H24O3Color and Shape:NeatMolecular weight:264.36
