
CAS 1340222-64-1
:5-(Chloromethyl)-1-(2-phenylethyl)-1H-tetrazole
Description:
5-(Chloromethyl)-1-(2-phenylethyl)-1H-tetrazole is a chemical compound characterized by its tetrazole ring, which is a five-membered ring containing four nitrogen atoms and one carbon atom. This compound features a chloromethyl group, which enhances its reactivity, and a phenylethyl substituent that contributes to its structural complexity and potential biological activity. The presence of the chloromethyl group suggests that it may participate in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. The tetrazole moiety is known for its diverse applications, including use in pharmaceuticals, agrochemicals, and as a building block in the synthesis of various bioactive compounds. Additionally, the compound's unique structure may impart specific properties such as solubility and stability, which are critical for its application in research and development. Overall, 5-(Chloromethyl)-1-(2-phenylethyl)-1H-tetrazole is a versatile compound with potential implications in medicinal chemistry and material science.
Formula:C10H11ClN4
InChI:InChI=1S/C10H11ClN4/c11-8-10-12-13-14-15(10)7-6-9-4-2-1-3-5-9/h1-5H,6-8H2
InChI key:InChIKey=BBBVJRYBOJQWDN-UHFFFAOYSA-N
SMILES:C(CC1=CC=CC=C1)N2C(CCl)=NN=N2
Synonyms:- 5-(Chloromethyl)-1-(2-phenylethyl)-1H-tetrazole
- 1H-Tetrazole, 5-(chloromethyl)-1-(2-phenylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.