CAS 13403-24-2

4,6-O-Ethylidene-D-glucose

Description:

4,6-O-Ethylidene-D-glucose is a derivative of D-glucose, characterized by the presence of an ethylidene group at the 4 and 6 positions of the glucose molecule. This modification alters its chemical properties and reactivity compared to standard D-glucose. The compound typically exists as a white crystalline solid and is soluble in water, reflecting the polar nature of its hydroxyl groups. It is often used in biochemical applications, particularly in carbohydrate chemistry, due to its ability to participate in various reactions, including glycosylation and other transformations. The ethylidene group can influence the stability and reactivity of the molecule, making it a useful intermediate in synthetic organic chemistry. Additionally, 4,6-O-ethylidene-D-glucose can be utilized in studies related to enzyme activity and carbohydrate metabolism, providing insights into the behavior of sugars in biological systems. As with many sugar derivatives, it is important to handle it with care, considering potential reactivity and safety protocols in laboratory settings.

Formula: C₈H₁₄O₆

InChI: InChI=1S/C8H14O6/c1-4-13-3-6(11)8(14-4)7(12)5(10)2-9/h2,4-8,10-12H,3H2,1H3/t4?,5-,6+,7+,8+/m0/s1

InChI key: InChIKey=CYJNDOQNVXFIJC-XUQKIGAKSA-N

SMILES: [C@H]([C@H](C=O)O)(O)[C@]1([C@H](O)COC(C)O1)[H]

Synonyms:

• 4,6-O-Ethylidene-D-glucose
• D-Glucose, 4,6-O-ethylidene-