
CAS 134031-25-7
:(2,4-Dichloro-3-pyridinyl)phenylmethanone
Description:
(2,4-Dichloro-3-pyridinyl)phenylmethanone, with the CAS number 134031-25-7, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a phenylmethanone moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including stability and potential reactivity due to the presence of chlorine substituents on the pyridine ring. The dichloro substitution can influence its electronic properties, making it a candidate for various chemical reactions, including electrophilic aromatic substitution. Additionally, the presence of the carbonyl group in the phenylmethanone structure contributes to its reactivity, particularly in nucleophilic addition reactions. This compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvents used. Overall, (2,4-Dichloro-3-pyridinyl)phenylmethanone is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C12H7Cl2NO
InChI:InChI=1S/C12H7Cl2NO/c13-9-6-7-15-12(14)10(9)11(16)8-4-2-1-3-5-8/h1-7H
InChI key:InChIKey=MXMUPWBBSLEKBP-UHFFFAOYSA-N
SMILES:C(=O)(C=1C(Cl)=CC=NC1Cl)C2=CC=CC=C2
Synonyms:- Methanone, (2,4-dichloro-3-pyridinyl)phenyl-
- (2,4-Dichloro-3-pyridinyl)phenylmethanone
- 3-Benzoyl-2,4-dichloropyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
