
CAS 134036-53-6
:3-Amino-4-(1H-indol-5-ylmethylene)-2-pentenetricarbonitrile
Description:
3-Amino-4-(1H-indol-5-ylmethylene)-2-pentenetricarbonitrile, with the CAS number 134036-53-6, is a chemical compound characterized by its complex structure, which includes an indole moiety and multiple cyano groups. This compound typically exhibits properties associated with both amines and nitriles, such as potential basicity due to the amino group and reactivity due to the presence of cyano groups. It may display significant biological activity, making it of interest in medicinal chemistry and drug development. The indole structure often contributes to aromaticity and can participate in various chemical reactions, including electrophilic substitutions. Additionally, the presence of multiple cyano groups suggests potential applications in materials science, particularly in the synthesis of polymers or as precursors for other chemical transformations. The compound's solubility, stability, and reactivity can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, this compound represents a unique intersection of organic chemistry and potential pharmacological applications.
Formula:C15H9N5
InChI:InChI=1S/C15H9N5/c16-7-12(15(19)13(8-17)9-18)6-10-1-2-14-11(5-10)3-4-20-14/h1-6,20H,19H2
InChI key:InChIKey=CMMDWEJTQUTCKG-UHFFFAOYSA-N
SMILES:C(=C(C(=C(C#N)C#N)N)C#N)C=1C=C2C(=CC1)NC=C2
Synonyms:- NSC 651712
- AG 370
- 2-Pentenetricarbonitrile, 3-amino-4-(1H-indol-5-ylmethylene)-
- 1,3-Butadiene-1,1,3-tricarbonitrile, 2-amino-4-(1H-indol-5-yl)-
- 3-Amino-4-(1H-indol-5-ylmethylene)-2-pentenetricarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
AG-370
CAS:AG 370, an indole tyrphostin, functions as a powerful inhibitor of PDGF-induced mitogenesis, demonstrating an IC50 of 20 μM.Formula:C15H9N5Color and Shape:SolidMolecular weight:259.27
