CymitQuimica logo

CAS 134044-50-1

:

2-(3-NITRO-PHENYL)-IMIDAZO[1,2-A]PYRIMIDINE

Description:
2-(3-Nitro-phenyl)-imidazo[1,2-a]pyrimidine is a heterocyclic compound characterized by its fused imidazole and pyrimidine rings, which contribute to its biological activity and chemical properties. The presence of a nitro group on the phenyl ring enhances its electron-withdrawing characteristics, potentially influencing its reactivity and solubility. This compound is often studied for its pharmacological properties, particularly in the context of medicinal chemistry, where it may exhibit activity against various biological targets. Its structural features allow for potential interactions with enzymes or receptors, making it a candidate for drug development. Additionally, the compound's stability and solubility in organic solvents can vary, affecting its application in synthesis and formulation. Overall, 2-(3-nitro-phenyl)-imidazo[1,2-a]pyrimidine represents a class of compounds with significant interest in research due to their diverse chemical behavior and potential therapeutic applications.
Formula:C12H8N4O2
InChI:InChI=1/C12H8N4O2/c17-16(18)10-4-1-3-9(7-10)11-8-15-6-2-5-13-12(15)14-11/h1-8H
SMILES:c1cc(cc(c1)N(=O)=O)c1cn2cccnc2n1
Synonyms:
  • Imidazo[1,2-A]Pyrimidine, 2-(3-Nitrophenyl)-
  • 2-(3-Nitro-phenyl)-imidazo[1,2-a] pyrimidine, >96%
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.