
CAS 134046-68-7
:N-(3,4-Dibromophenyl)-2-propenamide
Description:
N-(3,4-Dibromophenyl)-2-propenamide is an organic compound characterized by its amide functional group and a propenamide structure. It features a dibromophenyl moiety, which contributes to its unique chemical properties, including increased reactivity and potential for various substitution reactions due to the presence of bromine atoms. The compound is likely to exhibit moderate to high lipophilicity due to the aromatic ring, which can influence its solubility in organic solvents. Additionally, the presence of the propenamide group suggests potential for polymerization or other reactions typical of unsaturated amides. This compound may also display biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can affect its behavior in biological systems. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous. Overall, N-(3,4-Dibromophenyl)-2-propenamide is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C9H7Br2NO
InChI:InChI=1S/C9H7Br2NO/c1-2-9(13)12-6-3-4-7(10)8(11)5-6/h2-5H,1H2,(H,12,13)
InChI key:InChIKey=NVCPAURNARBUPS-UHFFFAOYSA-N
SMILES:N(C(C=C)=O)C1=CC(Br)=C(Br)C=C1
Synonyms:- 2-Propenamide, N-(3,4-dibromophenyl)-
- N-(3,4-Dibromophenyl)-2-propenamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.