CAS 134057-48-0
:2-Benzothiazolamine,5-fluoro-6-methoxy-(9CI)
Description:
2-Benzothiazolamine, 5-fluoro-6-methoxy- (9CI), with the CAS number 134057-48-0, is an organic compound characterized by its benzothiazole core, which is a bicyclic structure containing both a benzene ring and a thiazole ring. This compound features a fluorine atom and a methoxy group (-OCH3) as substituents, which can influence its chemical reactivity and biological activity. The presence of the fluorine atom often enhances the lipophilicity and metabolic stability of the molecule, while the methoxy group can affect its solubility and interaction with biological targets. 2-Benzothiazolamine derivatives are of interest in medicinal chemistry due to their potential pharmacological properties, including antimicrobial and anticancer activities. The compound's specific characteristics, such as melting point, solubility, and spectral data, would typically be determined through experimental methods. Overall, this compound represents a class of heterocyclic compounds that are valuable in various chemical and pharmaceutical applications.
Formula:C8H7FN2OS
InChI:InChI=1/C8H7FN2OS/c1-12-6-3-7-5(2-4(6)9)11-8(10)13-7/h2-3H,1H3,(H2,10,11)
SMILES:COc1cc2c(cc1F)[nH]c(=N)s2
Synonyms:- 5-Fluoro-6-Methoxy-1,3-Benzothiazol-2-Amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.