CAS 13407-16-4
:α-(Chloromethyl)-4-nitrobenzenemethanol
Description:
α-(Chloromethyl)-4-nitrobenzenemethanol, with the CAS number 13407-16-4, is an organic compound characterized by the presence of a chloromethyl group and a nitro group attached to a benzene ring. This compound typically exhibits a white to light yellow crystalline appearance. It is soluble in organic solvents, such as ethanol and acetone, but has limited solubility in water due to its hydrophobic aromatic structure. The presence of the nitro group contributes to its electron-withdrawing properties, which can influence its reactivity and potential applications in organic synthesis. The chloromethyl group serves as a reactive site for further chemical modifications, making it useful in the synthesis of various derivatives. Additionally, this compound may exhibit biological activity, which could be of interest in pharmaceutical research. However, handling should be approached with caution due to the potential toxicity associated with chlorinated compounds and nitro groups. Proper safety protocols should be followed when working with this substance in a laboratory setting.
Formula:C8H8ClNO3
InChI:InChI=1S/C8H8ClNO3/c9-5-8(11)6-1-3-7(4-2-6)10(12)13/h1-4,8,11H,5H2
InChI key:InChIKey=ZUJVGRUIXVTXOX-UHFFFAOYSA-N
SMILES:C(CCl)(O)C1=CC=C(N(=O)=O)C=C1
Synonyms:- α-(Chloromethyl)-4-nitrobenzenemethanol
- p-Nitrophenylchloromethylcarbinol
- Benzyl alcohol, α-(chloromethyl)-p-nitro-
- Benzenemethanol, α-(chloromethyl)-4-nitro-
- 2-Chloro-1-(4-nitro-phenyl)-ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
α-Chloromethyl-4-nitrobenzenemethanol
CAS:Controlled ProductFormula:C8H8ClNO3Color and Shape:NeatMolecular weight:201.607
