CAS 13407-63-1

5,6,7,8-tetrahydronaphthalene-2-carboxamide

Description:

5,6,7,8-Tetrahydronaphthalene-2-carboxamide, with the CAS number 13407-63-1, is an organic compound characterized by its naphthalene-derived structure, which features a saturated ring system. This compound contains a carboxamide functional group, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The presence of the tetrahydronaphthalene moiety suggests that it may exhibit hydrophobic properties, influencing its solubility and interaction with biological systems. Additionally, the compound's structural features may allow for specific interactions with biological targets, making it of interest in medicinal chemistry. Its stability and reactivity can be influenced by factors such as temperature, pH, and the presence of other chemical species. Overall, 5,6,7,8-tetrahydronaphthalene-2-carboxamide represents a unique chemical entity with potential utility in research and development, although specific applications would depend on further studies of its properties and behavior in various environments.

Formula: C₁₁H₁₃NO

InChI: InChI=1/C11H13NO/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h5-7H,1-4H2,(H2,12,13)

SMILES: C1CCc2cc(ccc2C1)C(=O)N

5,6,7,8-Tetrahydronaphthalene-2-carboxamide

CAS: 13407-63-1

5,6,7,8-Tetrahydronaphthalene-2-carboxamide is a substance that belongs to the category of alkoxy groups. It has a hydrogen atom and an oxygen atom. A methoxy group can be found in its structure. This substance also has a nitrogen atom and an alkyl group. 5,6,7,8-Tetrahydronaphthalene-2-carboxamide is an organic chemical with pharmacological properties. The substance is also known as 1-(3-(1-methylethyl)phenyl)-5,5-dimethylhydantoin. It has two different isomers: 2-(3-(1-methylethyl)phenyl)-5,5-dimethylhydantoin and 3-(3-(1-methylethyl)phenyl)-5,5-dimethylhydantoin.

Formula: C₁₁H₁₃NO

Purity: Min. 95%

Molecular weight: 175.23 g/mol

Ref: 3D-NAA40763