CAS 134074-64-9
:Oxpoconazole
Description:
Oxpoconazole is a chemical compound classified as a fungicide, primarily used in agricultural applications to control various fungal diseases in crops. It belongs to the class of triazole fungicides, which function by inhibiting the synthesis of ergosterol, an essential component of fungal cell membranes, thereby disrupting fungal growth and reproduction. Oxpoconazole is characterized by its broad-spectrum activity against a range of pathogenic fungi, making it effective in protecting crops from diseases such as powdery mildew and rust. The compound is typically applied as a foliar spray and is known for its systemic properties, allowing it to be absorbed by plants and provide prolonged protection. Its chemical structure includes a triazole ring, which is a common feature among many fungicides in this class. Additionally, Oxpoconazole has been evaluated for its environmental impact and safety profile, ensuring that it meets regulatory standards for use in agriculture. As with all chemical substances, proper handling and application according to safety guidelines are essential to minimize risks to human health and the environment.
Formula:C19H24ClN3O2
InChI:InChI=1/2C19H24ClN3O2.C4H4O4/c2*1-18(2)13-25-19(3,23(18)17(24)22-12-11-21-14-22)10-4-5-15-6-8-16(20)9-7-15;5-3(6)1-2-4(7)8/h2*6-9,11-12,14H,4-5,10,13H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;;2-1+
InChI key:InChIKey=FJBGIXKIXPUXBY-UHFFFAOYSA-N
SMILES:C(=O)(N1C(CCCC2=CC=C(Cl)C=C2)(C)OCC1(C)C)N3C=CN=C3
Synonyms:- Emizuo
- Methanone, [2-[3-(4-chlorophenyl)propyl]-2,4,4-trimethyl-3-oxazolidinyl]-1H-imidazol-1-yl-
- Oxazolidine, 2-[3-(4-chlorophenyl)propyl]-3-(1H-imidazol-1-ylcarbonyl)-2,4,4-trimethyl-
- Oxpoconazole [ISO]
- [2-[3-(4-Chlorophenyl)propyl]-2,4,4-trimethyl-3-oxazolidinyl]-1H-imidazol-1-ylmethanone
- {2-[3-(4-chlorophenyl)propyl]-2,4,4-trimethyl-1,3-oxazolidin-3-yl}(1H-imidazol-1-yl)methanone
- {2-[3-(4-chlorophenyl)propyl]-2,4,4-trimethyl-1,3-oxazolidin-3-yl}(1H-imidazol-1-yl)methanone (2E)-but-2-enedioate (2:1)
- Oxpoconazole
- [2-[3-(4-chlorophenyl)propyl]-2,4,4-trimethyl-1,3-oxazolidin-3-yl]-imidazol-1-ylmethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
