CAS 13409-53-5
:Podilfen
Description:
Podilfen, with the CAS number 13409-53-5, is a chemical compound that belongs to the class of phenothiazine derivatives. It is primarily recognized for its use in the field of pharmaceuticals, particularly as an antipsychotic agent. The compound exhibits a range of biological activities, including antipsychotic, antiemetic, and sedative effects, making it relevant in the treatment of various mental health disorders. Podilfen's mechanism of action typically involves the antagonism of dopamine receptors in the central nervous system, which helps to alleviate symptoms associated with psychosis. In terms of physical properties, Podilfen is generally characterized by its stability under standard conditions, although specific solubility and melting point values can vary. Safety data indicates that, like many pharmaceuticals, it should be handled with care, as it may have side effects and contraindications. Overall, Podilfen represents a significant compound in therapeutic applications, particularly in managing psychiatric conditions.
Formula:C18H23N3O2S
InChI:InChI=1/C18H23N3O2S/c1-13-11-24-18(19-13)21-7-5-20(6-8-21)14(2)9-15-3-4-16-17(10-15)23-12-22-16/h3-4,10-11,14H,5-9,12H2,1-2H3
SMILES:Cc1csc(n1)N1CCN(CC1)C(C)Cc1ccc2c(c1)OCO2
Synonyms:- 1-(alpha-Methyl-3,4-(methylenedioxy)phenethyl)-4-(4-methyl-2-thiazolyl)piperazine.
- 1-[1-(1,3-Benzodioxol-5-yl)propan-2-yl]-4-(4-methyl-1,3-thiazol-2-yl)piperazine
- 1-[a-Methyl-3,4-(methylenedioxy)phenethyl]-4-(4-methyl-2-thiazolyl)piperazine
- Piperazine, 1-[2-(1,3-Benzodioxol-5-Yl)-1-Methylethyl]-4-(4-Methyl-2-Thiazolyl)-
- Podilfen [INN]
- 1-[2-(1,3-Benzodioxol-5-Yl)-1-Methylethyl]-4-(4-Methyl-1,3-Thiazol-2-Yl)Piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
