CymitQuimica logo

CAS 134098-72-9

:

7-Nitro-2(3H)-benzothiazolone

Description:
7-Nitro-2(3H)-benzothiazolone is a chemical compound characterized by its unique structure, which includes a benzothiazole ring fused with a nitro group. This compound typically appears as a yellow to orange solid and is known for its applications in various fields, including organic synthesis and analytical chemistry. It exhibits notable properties such as being a potential fluorescent probe due to its ability to undergo specific chemical reactions, making it useful in detecting certain ions or molecules. The presence of the nitro group contributes to its reactivity and can influence its solubility in different solvents. Additionally, 7-Nitro-2(3H)-benzothiazolone may exhibit biological activity, which can be of interest in medicinal chemistry. Safety data should be consulted, as compounds of this nature may pose hazards if not handled properly. Overall, its distinctive chemical structure and properties make it a valuable compound for research and industrial applications.
Formula:C7H4N2O3S
InChI:InChI=1S/C7H4N2O3S/c10-7-8-4-2-1-3-5(9(11)12)6(4)13-7/h1-3H,(H,8,10)
InChI key:InChIKey=NQGONBNOWKZYTD-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(NC(=O)S2)=CC=C1
Synonyms:
  • 7-Nitro-2(3H)-benzothiazolone
  • 2(3H)-Benzothiazolone, 7-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.