CAS 134099-30-2: 2,4-Difluoro-3-(trifluoromethyl)benzaldehyde
Description:2,4-Difluoro-3-(trifluoromethyl)benzaldehyde is an aromatic aldehyde characterized by the presence of both fluorine substituents and a trifluoromethyl group on a benzene ring. The compound features two fluorine atoms located at the 2 and 4 positions relative to the aldehyde functional group, which is situated at the 1-position. The trifluoromethyl group (-CF3) is attached at the 3-position, contributing to the compound's unique electronic and steric properties. This structure enhances its reactivity and solubility in organic solvents, making it useful in various chemical syntheses and applications, particularly in the fields of pharmaceuticals and agrochemicals. The presence of multiple electronegative fluorine atoms increases the compound's polarity and can influence its interaction with biological systems. Additionally, 2,4-Difluoro-3-(trifluoromethyl)benzaldehyde may exhibit interesting photophysical properties, making it a candidate for further research in material science and organic synthesis. Safety precautions should be observed when handling this compound due to its potential toxicity and reactivity.
Formula:C8H3F5O
InChI:InChI=1S/C8H3F5O/c9-5-2-1-4(3-14)7(10)6(5)8(11,12)13/h1-3H
InChI key:InChIKey=IVVUVBIECSBSQR-UHFFFAOYSA-N
SMILES:O=CC1=CC=C(F)C(=C1F)C(F)(F)F
- Synonyms:
- Benzaldehyde, 2,4-difluoro-3-(trifluoromethyl)-
- 2,4-Difluoro-3-(trifluoromethyl)benzaldehyde
2,4-Difluoro-3-(trifluoromethyl)benzaldehyde
Ref: IN-DA00HT63
| 1g | 145.00 € | ||
| 5g | 470.00 € | ||
| 100mg | 43.00 € | ||
| 250mg | 59.00 € |
2,4-Difluoro-3-(trifluoromethyl)benzaldehyde
Ref: 54-PC51182
| 1g | 123.00 € | ||
| 5g | 381.00 € | ||
| 250mg | 51.00 € |
2,4-Difluoro-3-(trifluoromethyl)benzaldehyde
Ref: 10-F611492
| 1g | To inquire | ||
| 5g | To inquire | ||
| 250mg | To inquire |
2,4-Difluoro-3-(trifluoromethyl)benzaldehyde
Ref: 3D-JFA09930
| 2500mg | 531.00 € |
