CAS 134099-43-7
:4,5-Dichloro-2-(trifluoromethyl)benzaldehyde
Description:
4,5-Dichloro-2-(trifluoromethyl)benzaldehyde is an organic compound characterized by its aromatic structure, featuring a benzaldehyde functional group with two chlorine atoms and a trifluoromethyl group attached to the benzene ring. This compound is typically a pale yellow to light brown solid at room temperature and is known for its distinct odor associated with aldehydes. It is relatively stable under standard conditions but may undergo reactions typical of aldehydes, such as oxidation or nucleophilic addition. The presence of chlorine and trifluoromethyl groups contributes to its unique chemical reactivity and potential applications in pharmaceuticals, agrochemicals, and materials science. Additionally, the compound's molecular structure influences its solubility, making it more soluble in organic solvents than in water. Safety precautions should be taken when handling this substance, as it may pose health risks through inhalation or skin contact. Overall, 4,5-Dichloro-2-(trifluoromethyl)benzaldehyde is a valuable compound in synthetic organic chemistry.
Formula:C8H3Cl2F3O
InChI:InChI=1/C8H3Cl2F3O/c9-6-1-4(3-14)5(2-7(6)10)8(11,12)13/h1-3H
SMILES:c1c(C=O)c(cc(c1Cl)Cl)C(F)(F)F
Synonyms:- Benzaldehyde, 4,5-Dichloro-2-(Trifluoromethyl)-
- 4,5-Dichloro-2-(trifluoromethyl)benzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.