CAS 13410-15-6

6-Methoxymellein

Description:

6-Methoxymellein is a chemical compound known for its role in various biological and pharmacological contexts. It is a derivative of mellein, characterized by the presence of a methoxy group at the 6-position of the aromatic ring. This modification can influence its solubility, reactivity, and biological activity. The compound is typically classified as a phenolic compound, which often exhibits antioxidant properties. In terms of its physical characteristics, 6-Methoxymellein may appear as a crystalline solid, and its molecular structure contributes to its potential applications in medicinal chemistry and natural product synthesis. The compound has garnered interest for its potential therapeutic effects, including anti-inflammatory and antimicrobial activities. Additionally, its presence in certain plant species suggests a role in plant defense mechanisms. As with many organic compounds, the specific properties such as melting point, boiling point, and spectral data can vary and are essential for practical applications in research and industry.

Formula: C₁₁H₁₂O₄

InChI: InChI=1S/C11H12O4/c1-6-3-7-4-8(14-2)5-9(12)10(7)11(13)15-6/h4-6,12H,3H2,1-2H3/t6-/m1/s1

InChI key: InChIKey=AIFNAMVERSBWPS-ZCFIWIBFSA-N

SMILES: OC1=C2C(=CC(OC)=C1)C[C@@H](C)OC2=O

Synonyms:

• (-)-6-Methoxymellein
• Isocoumarin, 3,4-dihydro-8-hydroxy-6-methoxy-3-methyl-, (R)-(-)-
• (3R)-3,4-Dihydro-8-hydroxy-6-methoxy-3-methyl-1H-2-benzopyran-1-one
• 1H-2-Benzopyran-1-one, 3,4-dihydro-8-hydroxy-6-methoxy-3-methyl-, (R)-
• 1H-2-Benzopyran-1-one, 3,4-dihydro-8-hydroxy-6-methoxy-3-methyl-, (3R)-

6-Methoxymellein

CAS: 13410-15-6

6-Methoxymellein is a useful organic compound for research related to life sciences. The catalog number is T126021 and the CAS number is 13410-15-6.

Formula: C₁₁H₁₂O₄

Color and Shape: Solid

Molecular weight: 208.213

Ref: TM-T126021