CAS 134100-29-1

6-ACETAMIDO-6-DEOXY-CASTANOSPERMINE

Description:

6-Acetamido-6-deoxy-castanospermine is a synthetic compound that belongs to the class of alkaloids, specifically derived from the castanospermine family. It is characterized by the presence of an acetamido group and a deoxy sugar moiety, which contribute to its biological activity. This compound is known for its potential as an inhibitor of glycosidases, enzymes that play a crucial role in carbohydrate metabolism. Its structural features include a pyrrolidine ring and hydroxyl groups, which are essential for its interaction with enzyme active sites. The compound has garnered interest in medicinal chemistry due to its potential applications in treating viral infections and certain cancers, as it may interfere with glycoprotein processing. Additionally, its unique structural properties make it a subject of research in the development of new therapeutic agents. However, detailed studies on its pharmacokinetics, toxicity, and specific biological effects are necessary to fully understand its potential applications in medicine.

Formula: C₁₀H₁₈N₂O₄

InChI: InChI=1/C10H18N2O4/c1-5(13)11-6-4-12-3-2-7(14)8(12)10(16)9(6)15/h6-10,14-16H,2-4H2,1H3,(H,11,13)/t6-,7-,8+,9+,10+/m0/s1

Synonyms:

• Acetamide, N-(1S,6S,7R,8R,8aR)-octahydro-1,7,8-trihydroxy-6-indolizinyl-
• N-[(1S,6S,7R,8R,8aR)-1,7,8-trihydroxyoctahydroindolizin-6-yl]acetamide

6-Acetamido-6-deoxycastanospermine

CAS: 134100-29-1

6-Acetamido-6-deoxycastanospermine is a sophisticated glycosidase inhibitor, which is fundamentally an analog of castanospermine. This compound is derived synthetically, based on structural modifications of alkaloids extracted from natural sources such as the seeds of the Castanospermum australe. Its unique mode of action involves the inhibition of glycosidases, enzymes crucial for the hydrolysis of glycosidic bonds in carbohydrates.

Formula: C₁₀H₁₈N₂O₄·xH₂O

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 230.26 g/mol

Ref: 3D-MA10110