CAS 1341035-32-2

1,1-Dimethylethyl 5-(aminomethyl)-2-azaspiro[3.3]heptane-2-carboxylate

Description:

1,1-Dimethylethyl 5-(aminomethyl)-2-azaspiro[3.3]heptane-2-carboxylate, identified by its CAS number 1341035-32-2, is a chemical compound characterized by its unique spirocyclic structure, which includes a nitrogen atom in a bicyclic framework. This compound features a carboxylate functional group, contributing to its potential as a bioactive molecule. The presence of the dimethyl group enhances its steric properties, which may influence its reactivity and interactions with biological targets. The aminomethyl substituent suggests potential for hydrogen bonding, making it relevant in medicinal chemistry for drug design. Its spiro structure can impart rigidity, which is often beneficial for optimizing pharmacokinetic properties. Overall, this compound may exhibit interesting biological activities, making it a candidate for further research in fields such as pharmaceuticals and organic synthesis. However, specific properties such as solubility, melting point, and stability would require empirical investigation to fully characterize its behavior in various environments.

Formula: C₁₂H₂₂N₂O₂

InChI: InChI=1S/C12H22N2O2/c1-11(2,3)16-10(15)14-7-12(8-14)5-4-9(12)6-13/h9H,4-8,13H2,1-3H3

InChI key: InChIKey=OJWQZNMXCGURNC-UHFFFAOYSA-N

SMILES: C(N)C1C2(CN(C(OC(C)(C)C)=O)C2)CC1

Synonyms:

• tert-Butyl 5-(aminomethyl)-2-azaspiro[3.3]heptane-2-carboxylate
• 1,1-Dimethylethyl 5-(aminomethyl)-2-azaspiro[3.3]heptane-2-carboxylate
• 2-Azaspiro[3.3]heptane-2-carboxylic acid, 5-(aminomethyl)-, 1,1-dimethylethyl ester

tert-Butyl 5-(aminomethyl)-2-azaspiro[3.3]heptane-2-carboxylate

CAS: 1341035-32-2

Versatile small molecule scaffold

Formula: C₁₂H₂₂N₂O₂

Purity: Min. 95%

Molecular weight: 226.32 g/mol

Ref: 3D-RDC03532