CAS 1341035-71-9
:Methyl 5-hydroxy-3-methoxy-2-naphthalenecarboxylate
Description:
Methyl 5-hydroxy-3-methoxy-2-naphthalenecarboxylate is an organic compound characterized by its naphthalene backbone, which features hydroxyl and methoxy functional groups. This compound typically exhibits properties associated with aromatic compounds, such as stability and a tendency to engage in electrophilic substitution reactions. The presence of the hydroxyl group contributes to its potential solubility in polar solvents, while the methoxy group can influence its reactivity and interaction with other chemical species. Methyl esters, like this compound, are often used in organic synthesis and can serve as intermediates in the production of pharmaceuticals and agrochemicals. Additionally, the specific arrangement of substituents on the naphthalene ring can affect the compound's biological activity, making it of interest in medicinal chemistry. Overall, this compound's unique structure and functional groups suggest potential applications in various fields, including drug development and materials science.
Formula:C13H12O4
InChI:InChI=1S/C13H12O4/c1-16-12-7-9-8(4-3-5-11(9)14)6-10(12)13(15)17-2/h3-7,14H,1-2H3
InChI key:InChIKey=PYPSUZIVIHCEDR-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=C(C(OC)=O)C(OC)=C2)C=CC1
Synonyms:- Methyl 5-hydroxy-3-methoxy-2-naphthoate
- Methyl 5-hydroxy-3-methoxy-2-naphthalenecarboxylate
- 2-Naphthalenecarboxylic acid, 5-hydroxy-3-methoxy-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
