CAS 1341035-98-0
:1,1-Dimethylethyl 3-bromo-6-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-6,7-dihydro[1,2,3]triazolo[1,5-a]pyrazine-5(4H)-carboxylate
Description:
1,1-Dimethylethyl 3-bromo-6-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-6,7-dihydro[1,2,3]triazolo[1,5-a]pyrazine-5(4H)-carboxylate, with CAS number 1341035-98-0, is a complex organic compound characterized by its unique structural features. It contains a triazolo-pyrazine core, which is notable for its potential biological activity, particularly in medicinal chemistry. The presence of the 1,1-dimethylethyl (tert-butyl) groups contributes to its hydrophobic properties, potentially influencing its solubility and interaction with biological membranes. The bromine atom introduces a halogen, which can enhance reactivity and serve as a site for further chemical modifications. Additionally, the dimethylsilyl group provides stability and can affect the compound's electronic properties. This compound may exhibit interesting pharmacological activities, making it a candidate for further research in drug development. Its synthesis and characterization would require careful handling due to the presence of reactive functional groups, and its applications could span various fields, including pharmaceuticals and agrochemicals.
Formula:C17H31BrN4O3Si
InChI:InChI=1S/C17H31BrN4O3Si/c1-16(2,3)25-15(23)21-10-13-14(18)19-20-22(13)9-12(21)11-24-26(7,8)17(4,5)6/h12H,9-11H2,1-8H3
InChI key:InChIKey=NBUVVUBUCFRQDQ-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C(CO[Si](C(C)(C)C)(C)C)CN2C(C1)=C(Br)N=N2
Synonyms:- 1,1-Dimethylethyl 3-bromo-6-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-6,7-dihydro[1,2,3]triazolo[1,5-a]pyrazine-5(4H)-carboxylate
- [1,2,3]Triazolo[1,5-a]pyrazine-5(4H)-carboxylic acid, 3-bromo-6-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-6,7-dihydro-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.