
CAS 1341036-18-7
:2-[(1,1-Dimethylethoxy)carbonyl]-2-azaspiro[3.3]heptane-5-acetic acid
Description:
2-[(1,1-Dimethylethoxy)carbonyl]-2-azaspiro[3.3]heptane-5-acetic acid is a chemical compound characterized by its unique spirocyclic structure, which incorporates both a nitrogen atom and a carboxylic acid functional group. The presence of the 1,1-dimethylethoxy carbonyl group contributes to its stability and solubility in organic solvents. This compound is likely to exhibit moderate polarity due to the carboxylic acid group, which can participate in hydrogen bonding. Its spirocyclic framework may impart interesting conformational properties, potentially influencing its reactivity and interaction with biological targets. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the design of pharmaceuticals, where spiro compounds are often explored for their unique biological activities. Additionally, the presence of the azaspiro moiety may enhance its ability to interact with various biological systems, making it a candidate for further investigation in drug development. As with any chemical substance, safety and handling precautions should be observed, particularly due to the potential reactivity of the functional groups present.
Formula:C13H21NO4
InChI:InChI=1S/C13H21NO4/c1-12(2,3)18-11(17)14-7-13(8-14)5-4-9(13)6-10(15)16/h9H,4-8H2,1-3H3,(H,15,16)
InChI key:InChIKey=KTZGWMNXOQYJAK-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1C2(CN(C(OC(C)(C)C)=O)C2)CC1
Synonyms:- 2-Azaspiro[3.3]heptane-5-acetic acid, 2-[(1,1-dimethylethoxy)carbonyl]-
- 2-[(1,1-Dimethylethoxy)carbonyl]-2-azaspiro[3.3]heptane-5-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.