CAS 1341037-76-0
:Imidazo[5,1-d][1,2,5]benzothiadiazepine-3-carboxylic acid, 4,5-dihydro-, ethyl ester, 6,6-dioxide
Description:
Imidazo[5,1-d][1,2,5]benzothiadiazepine-3-carboxylic acid, 4,5-dihydro-, ethyl ester, 6,6-dioxide is a complex heterocyclic compound characterized by its unique bicyclic structure that incorporates both imidazole and benzothiadiazepine moieties. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity, while the ethyl ester group enhances its solubility and bioavailability. The presence of the 6,6-dioxide indicates that the compound has two oxygen atoms incorporated into the structure, which may influence its chemical properties and interactions. Typically, such compounds are of interest in medicinal chemistry due to their potential pharmacological activities, including antimicrobial, anti-inflammatory, or anticancer properties. The specific arrangement of atoms and functional groups in this compound can lead to diverse biological activities, making it a subject of research in drug development. However, detailed studies on its specific properties, such as solubility, stability, and biological activity, would be necessary to fully understand its potential applications.
Formula:C13H13N3O4S
InChI:InChI=1S/C13H13N3O4S/c1-2-20-13(17)12-10-7-15-21(18,19)11-6-4-3-5-9(11)16(10)8-14-12/h3-6,8,15H,2,7H2,1H3
InChI key:InChIKey=NYSDZRLNXBAWOM-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C2N(C=3C(S(=O)(=O)NC2)=CC=CC3)C=N1
Synonyms:- Imidazo[5,1-d][1,2,5]benzothiadiazepine-3-carboxylic acid, 4,5-dihydro-, ethyl ester, 6,6-dioxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.