CAS 1341037-81-7

2-Bromo-6-fluoro-N-methoxy-N-methylbenzamide

Description:

2-Bromo-6-fluoro-N-methoxy-N-methylbenzamide is an organic compound characterized by its aromatic structure, which includes a benzamide moiety substituted with bromine and fluorine atoms. The presence of the bromine atom at the 2-position and the fluorine atom at the 6-position on the benzene ring contributes to its unique reactivity and potential biological activity. The methoxy (-OCH3) and methyl (-CH3) groups attached to the nitrogen atom enhance its lipophilicity, potentially influencing its solubility and permeability in biological systems. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the electron-withdrawing effects of the halogen substituents. Additionally, the presence of functional groups such as the methoxy and methyl groups may affect its interaction with biological targets, making it a subject of interest in drug discovery and development.

Formula: C₉H₉BrFNO₂

InChI: InChI=1S/C9H9BrFNO2/c1-12(14-2)9(13)8-6(10)4-3-5-7(8)11/h3-5H,1-2H3

InChI key: InChIKey=MHVWXGSXMURULT-UHFFFAOYSA-N

SMILES: C(N(OC)C)(=O)C1=C(Br)C=CC=C1F

Synonyms:

• 2-Bromo-6-fluoro-N-methoxy-N-methylbenzamide
• Benzamide, 2-bromo-6-fluoro-N-methoxy-N-methyl-