CAS 1341037-94-2
:N-Methyl-3-azabicyclo[4.1.0]heptan-1-amine
Description:
N-Methyl-3-azabicyclo[4.1.0]heptan-1-amine, with the CAS number 1341037-94-2, is a bicyclic organic compound characterized by its unique bicyclic structure that includes a nitrogen atom within the ring system. This compound features a nitrogen atom at the 3-position of the bicyclic framework, contributing to its classification as a tertiary amine due to the presence of a methyl group attached to the nitrogen. The bicyclic structure imparts rigidity and specific spatial orientation, which can influence its reactivity and interaction with biological systems. N-Methyl-3-azabicyclo[4.1.0]heptan-1-amine may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. Its potential applications could span various fields, including medicinal chemistry, where it may serve as a scaffold for drug development or as a ligand in coordination chemistry. However, detailed studies on its pharmacological properties and safety profile would be necessary to fully understand its utility in these areas.
Formula:C7H14N2
InChI:InChI=1S/C7H14N2/c1-8-7-4-6(7)2-3-9-5-7/h6,8-9H,2-5H2,1H3
InChI key:InChIKey=RQVHRVSJYFXWNP-UHFFFAOYSA-N
SMILES:N(C)C12C(C1)CCNC2
Synonyms:- 3-Azabicyclo[4.1.0]heptan-1-amine, N-methyl-
- N-Methyl-3-azabicyclo[4.1.0]heptan-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.