CAS 1341038-06-9: 5-(2-Bromophenyl)-2-oxazolidinone

Description: 5-(2-Bromophenyl)-2-oxazolidinone is a chemical compound characterized by its oxazolidinone structure, which features a five-membered ring containing both nitrogen and oxygen atoms. The presence of the 2-bromophenyl group indicates that a bromine atom is substituted on the phenyl ring, influencing the compound's reactivity and potential biological activity. This compound is typically used in organic synthesis and may serve as an intermediate in the development of pharmaceuticals or agrochemicals. Its molecular structure suggests it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. The oxazolidinone moiety is known for its role in various therapeutic agents, particularly in antibiotic development. Additionally, the bromine substituent can enhance lipophilicity and alter the compound's solubility profile, which is crucial for its application in drug formulation. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous. Overall, 5-(2-Bromophenyl)-2-oxazolidinone represents a versatile compound with potential applications in chemical research and development.

Formula: C₉H₈BrNO₂

InChI: InChI=1S/C9H8BrNO2/c10-7-4-2-1-3-6(7)8-5-11-9(12)13-8/h1-4,8H,5H2,(H,11,12)

InChI key: InChIKey=PUKUZZNKOSNMBV-UHFFFAOYSA-N

SMILES: O=C1OC(C=2C=CC=CC2Br)CN1

Synonyms:

• 2-Oxazolidinone, 5-(2-bromophenyl)-
• 5-(2-Bromophenyl)-2-oxazolidinone

5-(2-Bromophenyl)oxazolidin-2-one

CAS: 1341038-06-9

Versatile small molecule scaffold

• Formula: C₉H₈NO₂Br
• Purity: Min. 95%
• Molecular weight: 242.06 g/mol

5-(2-BROMOPHENYL)OXAZOLIDIN-2-ONE

CAS: 1341038-06-9

• Purity: 95.0%
• Molecular weight: 242.07200622558594