CAS 1341038-88-7

1,1-Dimethylethyl 1-(aminomethyl)-3-azabicyclo[3.2.0]heptane-3-carboxylate

Description:

1,1-Dimethylethyl 1-(aminomethyl)-3-azabicyclo[3.2.0]heptane-3-carboxylate, identified by its CAS number 1341038-88-7, is a chemical compound characterized by its bicyclic structure, which includes a nitrogen atom in the ring, contributing to its classification as an azabicyclic compound. The presence of the dimethyl group indicates steric hindrance, which can influence its reactivity and interaction with biological systems. The aminomethyl group suggests potential for hydrogen bonding and reactivity, making it a candidate for various chemical reactions, including those involving nucleophiles. The carboxylate functional group indicates that it can participate in acid-base reactions and may exhibit solubility in polar solvents. This compound may have implications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. Overall, its unique structural characteristics suggest potential utility in various chemical and biological applications, although specific properties such as solubility, melting point, and reactivity would require empirical data for precise characterization.

Formula: C₁₂H₂₂N₂O₂

InChI: InChI=1S/C12H22N2O2/c1-11(2,3)16-10(15)14-6-9-4-5-12(9,7-13)8-14/h9H,4-8,13H2,1-3H3

InChI key: InChIKey=ROCVLKAYBDLJMG-UHFFFAOYSA-N

SMILES: C(N)C12C(CN(C(OC(C)(C)C)=O)C1)CC2

Synonyms:

• 3-Azabicyclo[3.2.0]heptane-3-carboxylic acid, 1-(aminomethyl)-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 1-(aminomethyl)-3-azabicyclo[3.2.0]heptane-3-carboxylate