CAS 134108-93-3

2-(Acetylamino)-6-O-[2-(acetylamino)-2-deoxy-β-D-glucopyranosyl]-2-deoxy-β-D-glucopyranose

Description:

2-(Acetylamino)-6-O-[2-(acetylamino)-2-deoxy-β-D-glucopyranosyl]-2-deoxy-β-D-glucopyranose, with CAS number 134108-93-3, is a complex carbohydrate derivative characterized by its structural components, which include two acetylamino groups and two deoxy-β-D-glucopyranose units. This compound features a glycosidic linkage, indicating that it is a glycoside, which is a type of molecule formed from a sugar and another functional group. The presence of acetylamino groups suggests that it may exhibit biological activity, potentially influencing its solubility and reactivity. The compound is likely to be soluble in polar solvents due to the hydroxyl groups present in the glucopyranose units. Its structural complexity may also confer specific interactions with biological macromolecules, making it of interest in pharmaceutical and biochemical research. Overall, this compound exemplifies the intricate nature of carbohydrate chemistry and its potential applications in various fields, including drug development and biochemistry.

Formula: C₁₆H₂₈N₂O₁₁

InChI: InChI=1S/C16H28N2O11/c1-5(20)17-9-13(24)12(23)8(28-15(9)26)4-27-16-10(18-6(2)21)14(25)11(22)7(3-19)29-16/h7-16,19,22-26H,3-4H2,1-2H3,(H,17,20)(H,18,21)/t7-,8-,9-,10-,11-,12-,13-,14-,15-,16-/m1/s1

InChI key: InChIKey=ZNYQSCCJIAFAQX-MVGRPQHISA-N

SMILES: O(C[C@@H]1[C@@H](O)[C@H](O)[C@@H](NC(C)=O)[C@H](O)O1)[C@H]2[C@H](NC(C)=O)[C@@H](O)[C@H](O)[C@@H](CO)O2

Synonyms:

• 2-(Acetylamino)-6-O-[2-(acetylamino)-2-deoxy-β-D-glucopyranosyl]-2-deoxy-β-D-glucopyranose
• β-D-Glucopyranose, 2-(acetylamino)-6-O-[2-(acetylamino)-2-deoxy-β-D-glucopyranosyl]-2-deoxy-

6-O-Glucopyranose N,N'-Diacetylchitobiose

Controlled Product

CAS: 134108-93-3

Formula: C₁₆H₂₈N₂O₁₁

Color and Shape: Neat

Molecular weight: 424.4

Ref: TR-G415635