CAS 1341098-73-4

4-[[(3-Bromophenyl)methyl]amino]-2-butanol

Description:

4-[[(3-Bromophenyl)methyl]amino]-2-butanol, with the CAS number 1341098-73-4, is an organic compound characterized by its complex structure that includes a butanol backbone substituted with a bromophenyl group and an amino group. This compound typically exhibits properties associated with both alcohols and amines, such as the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the bromine atom contributes to its reactivity, potentially allowing for electrophilic substitution reactions. Additionally, the compound may display biological activity due to its amine functionality, which can interact with various biological targets. Its molecular structure suggests that it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for precise applications. Safety data should also be consulted, as the presence of bromine may pose certain hazards.

Formula: C₁₁H₁₆BrNO

InChI: InChI=1S/C11H16BrNO/c1-9(14)5-6-13-8-10-3-2-4-11(12)7-10/h2-4,7,9,13-14H,5-6,8H2,1H3

InChI key: InChIKey=BRFUPPPZRKBTMF-UHFFFAOYSA-N

SMILES: C(NCCC(C)O)C1=CC(Br)=CC=C1

Synonyms:

• 2-Butanol, 4-[[(3-bromophenyl)methyl]amino]-
• 4-[[(3-Bromophenyl)methyl]amino]-2-butanol