CAS 134111-32-3
:2'-deoxy-4'-thiouridine
Description:
2'-Deoxy-4'-thiouridine is a modified nucleoside that features a deoxyribose sugar and a thiouracil base. This compound is characterized by the presence of a sulfur atom in the 4-position of the uracil ring, which distinguishes it from regular deoxyuridine. It is typically represented by the molecular formula C9H11N2O4S. The substitution of sulfur for oxygen in the uracil moiety can influence the compound's biochemical properties, including its stability and interaction with nucleic acid synthesis enzymes. 2'-Deoxy-4'-thiouridine has been studied for its potential applications in antiviral and anticancer therapies, as it may interfere with nucleic acid metabolism. Additionally, its incorporation into RNA or DNA can affect the structure and function of these molecules, making it a subject of interest in molecular biology and medicinal chemistry. The compound is soluble in water and exhibits characteristics typical of nucleosides, such as the ability to form hydrogen bonds and participate in base pairing.
Formula:C9H12N2O4S
InChI:InChI=1/C9H12N2O4S/c12-4-6-5(13)3-8(16-6)11-2-1-7(14)10-9(11)15/h1-2,5-6,8,12-13H,3-4H2,(H,10,14,15)/t5-,6+,8?/m0/s1
Synonyms:- 1'-Deoxy-4'-thiouridine
- 2-Dtud
- Uridine, 2'-deoxy-4'-thio-
- 2'-Deoxy-4'-thiouridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2'-Deoxy-4'-thiouridine
CAS:2'-Deoxy-4'-thiouridine (2dT) is a synthetic purine nucleoside analogue that has antiviral activity against herpes simplex virus and hepatitis B virus. It is a lead compound for the development of therapeutic agents for human immunodeficiency virus type 1 and varicella, and it has potential applications in the treatment of renal toxicity. 2dT inhibits viral replication by inhibiting viral thymidine kinase, which converts 2dT to 2'-deoxy-4'-thioguanosine monophosphate (2'TGMP). The 2'TGMP inhibits intracellular phosphorylation reactions necessary for DNA synthesis and cell division. This inhibition leads to death of the infected cells.
Formula:C9H12N2O4SPurity:Min. 95%Molecular weight:244.27 g/mol
