CAS 134130-20-4

9,9-bis{4-[(trifluoroethenyl)oxy]phenyl}-9H-fluorene

Description:

9,9-bis{4-[(trifluoroethenyl)oxy]phenyl}-9H-fluorene, with CAS number 134130-20-4, is an organic compound characterized by its unique molecular structure that includes a fluorene core substituted with two 4-(trifluoroethenyl)oxyphenyl groups. This compound exhibits notable properties such as high thermal stability and potential applications in organic electronics, particularly in organic light-emitting diodes (OLEDs) and organic photovoltaics due to its ability to facilitate charge transport. The presence of trifluoroethenyl groups enhances its electron-withdrawing characteristics, which can influence its reactivity and solubility in various solvents. Additionally, the fluorene moiety contributes to its photophysical properties, making it suitable for applications requiring specific light absorption and emission characteristics. Overall, this compound's distinctive structural features and functional groups make it a subject of interest in materials science and organic chemistry research.

Formula: C₂₉H₁₆F₆O₂

InChI: InChI=1/C29H16F6O2/c30-25(31)27(34)36-19-13-9-17(10-14-19)29(18-11-15-20(16-12-18)37-28(35)26(32)33)23-7-3-1-5-21(23)22-6-2-4-8-24(22)29/h1-16H

SMILES: c1ccc2c(c1)c1ccccc1C2(c1ccc(cc1)OC(=C(F)F)F)c1ccc(cc1)OC(=C(F)F)F

Synonyms:

• 9,9-Bis{4-[(trifluorovinyl)oxy]phenyl}-9H-fluorene
• 9H-Fluorene, 9,9-bis[4-[(1,2,2-trifluoroethenyl)oxy]phenyl]-

9,9-Bis[4-(1,2,2-trfluorovinyloxy)phenyl]-9H-fluorene

CAS: 134130-20-4

9,9-Bis[4-(1,2,2-trfluorovinyloxy)phenyl]-9H-fluorene

Purity: 98

Color and Shape: Solid

Molecular weight: 510.43g/mol

Ref: 54-PC450045