CAS 13414-55-6
:2,3-Dihydro-2,2-dimethyl-7-nitrobenzofuran
Description:
2,3-Dihydro-2,2-dimethyl-7-nitrobenzofuran, identified by its CAS number 13414-55-6, is a chemical compound that belongs to the class of benzofurans, which are characterized by a fused benzene and furan ring structure. This particular compound features a nitro group, which is a common functional group in organic chemistry, known for its electron-withdrawing properties. The presence of the dimethyl groups contributes to its steric hindrance and may influence its reactivity and solubility. Typically, compounds like this may exhibit interesting biological activities, making them of interest in medicinal chemistry and pharmacology. The molecular structure suggests potential applications in various fields, including materials science and organic synthesis. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications. Safety data should also be consulted, as nitro compounds can pose health risks and require careful handling.
Formula:C10H11NO3
InChI:InChI=1S/C10H11NO3/c1-10(2)6-7-4-3-5-8(11(12)13)9(7)14-10/h3-5H,6H2,1-2H3
InChI key:InChIKey=ZQZNLPNVEXRNNG-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(CC(C)(C)O2)=CC=C1
Synonyms:- 2,2-Dimethyl-7-Nitro-2,3-Dihydro-1-Benzofuran
- Benzofuran, 2,3-dihydro-2,2-dimethyl-7-nitro-
- 2,3-Dihydro-2,2-dimethyl-7-nitrobenzofuran
- 2,3-Dihydro-2,2-dimethyl-7-nitrobenzofuran
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2,3-Dihydro-2,2-dimethyl-7-nitrobenzofuran
CAS:Controlled ProductFormula:C10H11NO3Color and Shape:NeatMolecular weight:193.1992,3-Dihydro-2,2-dimethyl-7-nitrobenzofuran
CAS:<p>2,3-Dihydro-2,2-dimethyl-7-nitrobenzofuran is an inhibitor of kinases that has shown potential as a tumor analog in human cancer cells. It inhibits the activity of kinases involved in cell signaling pathways that are crucial for the survival and growth of cancer cells. This compound has been found to be effective against various types of cancer, including renal cell carcinoma, breast cancer, and leukemia. It has also been shown to enhance the antitumor activity of other drugs such as dabigatran and artesunate. 2,3-Dihydro-2,2-dimethyl-7-nitrobenzofuran induces apoptosis in cancer cells by activating caspase-dependent pathways. This compound can be detected in urine and may have potential therapeutic applications for the treatment of cancer.</p>Formula:C10H11NO3Purity:Min. 95%Molecular weight:193.2 g/mol

