CAS 134152-13-9
:2,6-difluorophenyl-N-tert-butylnitrone
Description:
2,6-Difluorophenyl-N-tert-butylnitrone is an organic compound characterized by its unique structure, which includes a nitrone functional group attached to a 2,6-difluorophenyl moiety and a tert-butyl group. The presence of fluorine atoms on the aromatic ring enhances the compound's reactivity and stability, making it of interest in various chemical applications, including organic synthesis and as a potential spin trap in radical chemistry. The tert-butyl group contributes to steric hindrance, influencing the compound's interactions and solubility in different solvents. This compound is typically used in research settings, particularly in studies involving free radicals and oxidative stress. Its specific properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances. As with many nitrone compounds, it may exhibit interesting magnetic properties due to the presence of unpaired electrons, making it valuable in the field of spin chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C11H14F2NO
InChI:InChI=1/C11H14F2NO/c1-11(2,3)14(15)7-8-9(12)5-4-6-10(8)13/h4-6H,7H2,1-3H3
SMILES:CC(C)(C)N(Cc1c(cccc1F)F)O
Synonyms:- 2,6-Dptbn
- Nitroxide, (2,6-difluorophenyl)methyl 1,1-dimethylethyl
- [Tert-Butyl(2,6-Difluorobenzyl)Amino]Oxidanyl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.