CymitQuimica logo

CAS 134152-15-1

:

Homotaurine N,N-Diacetic Acid

Description:
Homotaurine N,N-Diacetic Acid, identified by its CAS number 134152-15-1, is a synthetic compound that belongs to the class of amino acids and their derivatives. It features a homotaurine backbone, which is a modified form of taurine, with two acetic acid groups attached to the nitrogen atom. This structure imparts unique chelating properties, allowing it to effectively bind metal ions, which can be beneficial in various applications, including biochemistry and pharmaceuticals. The compound is typically characterized by its solubility in water, making it suitable for biological studies and formulations. Additionally, it may exhibit biological activity, potentially influencing cellular processes or serving as a precursor in the synthesis of other bioactive molecules. Its stability and reactivity can vary depending on environmental conditions such as pH and temperature. Overall, Homotaurine N,N-Diacetic Acid is of interest in research areas focused on metal ion interactions and therapeutic applications.
Formula:C7H13NO7S
InChI:InChI=1/C7H13NO7S/c9-6(10)4-8(5-7(11)12)2-1-3-16(13,14)15/h1-5H2,(H,9,10)(H,11,12)(H,13,14,15)
SMILES:C(CN(CC(=O)O)CC(=O)O)CS(=O)(=O)O
Synonyms:
  • N-(Carboxymethyl)-N-(3-sulfopropyl)-glycine
  • N,N-diacetylhomotaurine
  • 2,2'-[(3-Sulfopropyl)Imino]Diacetic Acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.