CAS 1341657-66-6

1-Piperidinesulfonamide, 4-(methoxymethyl)-

Description:

1-Piperidinesulfonamide, 4-(methoxymethyl)- is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a sulfonamide group contributes to its potential biological activity, often enhancing solubility and reactivity. The methoxymethyl substituent at the 4-position of the piperidine ring introduces additional steric and electronic properties, which can influence the compound's interaction with biological targets. This compound may exhibit properties typical of sulfonamides, such as antibacterial activity, although specific biological activities would depend on its precise structure and substituents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's CAS number, 1341657-66-6, allows for easy identification and retrieval of information in chemical databases. Overall, the characteristics of 1-Piperidinesulfonamide, 4-(methoxymethyl)- make it a compound of interest in various fields, including drug discovery and development.

Formula: C₇H₁₆N₂O₃S

InChI: InChI=1S/C7H16N2O3S/c1-12-6-7-2-4-9(5-3-7)13(8,10)11/h7H,2-6H2,1H3,(H2,8,10,11)

InChI key: InChIKey=YXDKGJPXKCVZQZ-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)N1CCC(COC)CC1

Synonyms:

• 1-Piperidinesulfonamide, 4-(methoxymethyl)-
• 4-(Methoxymethyl)piperidine-1-sulfonamide

4-(Methoxymethyl)piperidine-1-sulfonamide

CAS: 1341657-66-6

Versatile small molecule scaffold

Formula: C₇H₁₆N₂O₃S

Purity: Min. 95%

Molecular weight: 208.28 g/mol

Ref: 3D-RDC65766