
CAS 1341711-91-8
:N,N-Dimethyl-2-[[1-(2-thiazolyl)ethyl]amino]acetamide
Description:
N,N-Dimethyl-2-[[1-(2-thiazolyl)ethyl]amino]acetamide, identified by its CAS number 1341711-91-8, is a chemical compound characterized by its unique structural features, which include a dimethylamino group and a thiazole moiety. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential biological activity due to the presence of the thiazole ring, which is known for its role in various pharmacological applications. The thiazole group can contribute to the compound's ability to interact with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of the dimethylamino group may enhance lipophilicity, influencing its absorption and distribution in biological systems. Overall, this compound's characteristics suggest potential utility in drug development, particularly in areas related to antimicrobial or anticancer research, although specific biological activities would require further investigation through experimental studies.
Formula:C9H15N3OS
InChI:InChI=1S/C9H15N3OS/c1-7(9-10-4-5-14-9)11-6-8(13)12(2)3/h4-5,7,11H,6H2,1-3H3
InChI key:InChIKey=HZUGIUGOPTYSCR-UHFFFAOYSA-N
SMILES:C(NCC(N(C)C)=O)(C)C1=NC=CS1
Synonyms:- N,N-Dimethyl-2-[[1-(2-thiazolyl)ethyl]amino]acetamide
- Acetamide, N,N-dimethyl-2-[[1-(2-thiazolyl)ethyl]amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.