CAS 1341729-34-7
:2-Amino-1-(1,3-dihydro-2H-isoindol-2-yl)-1-propanone
Description:
2-Amino-1-(1,3-dihydro-2H-isoindol-2-yl)-1-propanone, identified by its CAS number 1341729-34-7, is a chemical compound characterized by its unique structural features, which include an amino group and a ketone functional group. This compound belongs to a class of molecules that may exhibit biological activity, potentially serving as intermediates in the synthesis of pharmaceuticals or other bioactive compounds. The presence of the isoindole moiety suggests that it may participate in various chemical reactions, including those involving nucleophilic substitutions or cyclizations. Its solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of interest in medicinal chemistry. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, would be essential for understanding its behavior in different environments and applications. Overall, 2-Amino-1-(1,3-dihydro-2H-isoindol-2-yl)-1-propanone represents a complex structure with potential implications in chemical research and development.
Formula:C11H14N2O
InChI:InChI=1S/C11H14N2O/c1-8(12)11(14)13-6-9-4-2-3-5-10(9)7-13/h2-5,8H,6-7,12H2,1H3
InChI key:InChIKey=ROGSNODZJLQUKG-UHFFFAOYSA-N
SMILES:C(C(C)N)(=O)N1CC=2C(C1)=CC=CC2
Synonyms:- 2-Amino-1-(1,3-dihydro-2H-isoindol-2-yl)-1-propanone
- 1-Propanone, 2-amino-1-(1,3-dihydro-2H-isoindol-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.